![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Skunk.mp3 | 2005-06-28 14:51 | 766K | |
| 02. To myself.mp3 | 2005-06-28 14:52 | 5.0M | |
| 04. 국적은 대한민국.mp3 | 2005-06-28 14:52 | 1.3M | |
| 05. 언덕위의 하얀집.mp3 | 2005-06-28 14:53 | 6.0M | |
| 06. Morning.mp3 | 2005-06-28 14:53 | 5.3M | |
| 07. Rain.mp3 | 2005-06-28 14:54 | 5.9M | |
| 08. 아직까지는.mp3 | 2005-06-28 14:54 | 6.5M | |
| 09. 2집 이야기.mp3 | 2005-06-28 14:54 | 2.9M | |
| 10. Wanna Be Loved.mp3 | 2005-06-28 14:55 | 5.4M | |
| 11. King Of Kingz.mp3 | 2005-06-28 14:55 | 5.7M | |
| 12. 꿈을 꿔봐.mp3 | 2005-06-28 14:56 | 4.8M | |
| 13. 자화상.mp3 | 2005-06-28 14:57 | 5.5M | |
| 14. 서울 북쪽에서.mp3 | 2005-06-28 14:57 | 1.0M | |
| 15. No Chemical.mp3 | 2005-06-28 14:57 | 5.4M | |
| 16. 쑥부쟁이.mp3 | 2005-06-28 14:58 | 5.3M | |
| 스토니스컹크-03. Best seller.mp3 | 2005-06-28 14:58 | 5.8M | |